2-phenoxy-2-phenylacetic acid

C14H12O3 — CID 18384

IUPAC2-phenoxy-2-phenylacetic acid
SMILESO=C(O)C(Oc1ccccc1)c1ccccc1
InChIInChI=1S/C14H12O3/c15-14(16)13(11-7-3-1-4-8-11)17-12-9-5-2-6-10-12/h1-10,13H,(H,15,16)
InChIKeyABUKMOCUMIPDHV-UHFFFAOYSA-N
MW228.25 g/mol
LogP2.89
Rot. Bonds4

About 2-phenoxy-2-phenylacetic acid

2-phenoxy-2-phenylacetic acid (PubChem CID 18384) has the molecular formula C14H12O3 and a molecular weight of 228.25 g/mol. Its IUPAC name is 2-phenoxy-2-phenylacetic acid.

Molecular Properties

Compound Name2-phenoxy-2-phenylacetic acid
PubChem CID18384
Molecular FormulaC14H12O3
Molecular Weight228.25 g/mol
Exact Mass228.08
IUPAC Name2-phenoxy-2-phenylacetic acid
SMILESO=C(O)C(Oc1ccccc1)c1ccccc1
InChIInChI=1S/C14H12O3/c15-14(16)13(11-7-3-1-4-8-11)17-12-9-5-2-6-10-12/h1-10,13H,(H,15,16)
InChIKeyABUKMOCUMIPDHV-UHFFFAOYSA-N
XLogP2.89
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.25
LogP ≤ 52.89
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-phenoxy-2-phenylacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-phenoxy-2-phenylacetic acid?
The IUPAC name of 2-phenoxy-2-phenylacetic acid (CID 18384) is 2-phenoxy-2-phenylacetic acid.
What is the SMILES notation for 2-phenoxy-2-phenylacetic acid?
The canonical SMILES for 2-phenoxy-2-phenylacetic acid is O=C(O)C(Oc1ccccc1)c1ccccc1.
What is the InChIKey of 2-phenoxy-2-phenylacetic acid?
The InChIKey is ABUKMOCUMIPDHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O3/c15-14(16)13(11-7-3-1-4-8-11)17-12-9-5-2-6-10-12/h1-10,13H,(H,15,16).
What are the key properties of 2-phenoxy-2-phenylacetic acid?
2-phenoxy-2-phenylacetic acid has a molecular weight of 228.25 g/mol, XLogP of 2.89, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenoxy-2-phenylacetic acid is sourced from PubChem (CID 18384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).