C26H33N7O — CID 18384706
1-tert-butyl-5-methyl-4-pentyl-3-[[4-[4-(2H-tetrazol-5-yl)-3-pyridinyl]phenyl]methyl]imidazol-2-one (PubChem CID 18384706) has the molecular formula C26H33N7O and a molecular weight of 459.60 g/mol. Its IUPAC name is 1-tert-butyl-5-methyl-4-pentyl-3-[[4-[4-(2H-tetrazol-5-yl)-3-pyridinyl]phenyl]methyl]imidazol-2-one.
| Compound Name | 1-tert-butyl-5-methyl-4-pentyl-3-[[4-[4-(2H-tetrazol-5-yl)-3-pyridinyl]phenyl]methyl]imidazol-2-one |
|---|---|
| PubChem CID | 18384706 |
| Molecular Formula | C26H33N7O |
| Molecular Weight | 459.60 g/mol |
| Exact Mass | 459.27 |
| IUPAC Name | 1-tert-butyl-5-methyl-4-pentyl-3-[[4-[4-(2H-tetrazol-5-yl)-3-pyridinyl]phenyl]methyl]imidazol-2-one |
| SMILES | CCCCCc1c(C)n(C(C)(C)C)c(=O)n1Cc1ccc(-c2cnccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C26H33N7O/c1-6-7-8-9-23-18(2)33(26(3,4)5)25(34)32(23)17-19-10-12-20(13-11-19)22-16-27-15-14-21(22)24-28-30-31-29-24/h10-16H,6-9,17H2,1-5H3,(H,28,29,30,31) |
| InChIKey | DJGXVQSSWCVJHT-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.60 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|