C21H19FO5S — CID 18385587
3-(3-fluorophenyl)-2-(4-methylsulfonylphenyl)-1,8-dioxaspiro[4.5]dec-2-en-4-one (PubChem CID 18385587) has the molecular formula C21H19FO5S and a molecular weight of 402.44 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-2-(4-methylsulfonylphenyl)-1,8-dioxaspiro[4.5]dec-2-en-4-one.
| Compound Name | 3-(3-fluorophenyl)-2-(4-methylsulfonylphenyl)-1,8-dioxaspiro[4.5]dec-2-en-4-one |
|---|---|
| PubChem CID | 18385587 |
| Molecular Formula | C21H19FO5S |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 3-(3-fluorophenyl)-2-(4-methylsulfonylphenyl)-1,8-dioxaspiro[4.5]dec-2-en-4-one |
| SMILES | CS(=O)(=O)c1ccc(C2=C(c3cccc(F)c3)C(=O)C3(CCOCC3)O2)cc1 |
| InChI | InChI=1S/C21H19FO5S/c1-28(24,25)17-7-5-14(6-8-17)19-18(15-3-2-4-16(22)13-15)20(23)21(27-19)9-11-26-12-10-21/h2-8,13H,9-12H2,1H3 |
| InChIKey | JLOWVLSORWMFFQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|