About 4-(3,5-difluorophenyl)-5-(3-fluoro-4-methylsulfanylphenyl)-2,2-dimethylfuran-3-thione
4-(3,5-difluorophenyl)-5-(3-fluoro-4-methylsulfanylphenyl)-2,2-dimethylfuran-3-thione (PubChem CID 18385763) has the molecular formula C19H15F3OS2
and a molecular weight of 380.46 g/mol. Its IUPAC name is 4-(3,5-difluorophenyl)-5-(3-fluoro-4-methylsulfanylphenyl)-2,2-dimethylfuran-3-thione.
Molecular Properties
| Compound Name | 4-(3,5-difluorophenyl)-5-(3-fluoro-4-methylsulfanylphenyl)-2,2-dimethylfuran-3-thione |
| PubChem CID | 18385763 |
| Molecular Formula | C19H15F3OS2 |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | 4-(3,5-difluorophenyl)-5-(3-fluoro-4-methylsulfanylphenyl)-2,2-dimethylfuran-3-thione |
| SMILES | CSc1ccc(C2=C(c3cc(F)cc(F)c3)C(=S)C(C)(C)O2)cc1F |
| InChI | InChI=1S/C19H15F3OS2/c1-19(2)18(24)16(11-6-12(20)9-13(21)7-11)17(23-19)10-4-5-15(25-3)14(22)8-10/h4-9H,1-3H3 |
| InChIKey | VJDBNTHKGLNMMH-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,5-difluorophenyl)-5-(3-fluoro-4-methylsulfanylphenyl)-2,2-dimethylfuran-3-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,5-difluorophenyl)-5-(3-fluoro-4-methylsulfanylphenyl)-2,2-dimethylfuran-3-thione?
The IUPAC name of 4-(3,5-difluorophenyl)-5-(3-fluoro-4-methylsulfanylphenyl)-2,2-dimethylfuran-3-thione (CID 18385763) is 4-(3,5-difluorophenyl)-5-(3-fluoro-4-methylsulfanylphenyl)-2,2-dimethylfuran-3-thione.
What is the SMILES notation for 4-(3,5-difluorophenyl)-5-(3-fluoro-4-methylsulfanylphenyl)-2,2-dimethylfuran-3-thione?
The canonical SMILES for 4-(3,5-difluorophenyl)-5-(3-fluoro-4-methylsulfanylphenyl)-2,2-dimethylfuran-3-thione is CSc1ccc(C2=C(c3cc(F)cc(F)c3)C(=S)C(C)(C)O2)cc1F.
What is the InChIKey of 4-(3,5-difluorophenyl)-5-(3-fluoro-4-methylsulfanylphenyl)-2,2-dimethylfuran-3-thione?
The InChIKey is VJDBNTHKGLNMMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15F3OS2/c1-19(2)18(24)16(11-6-12(20)9-13(21)7-11)17(23-19)10-4-5-15(25-3)14(22)8-10/h4-9H,1-3H3.
What are the key properties of 4-(3,5-difluorophenyl)-5-(3-fluoro-4-methylsulfanylphenyl)-2,2-dimethylfuran-3-thione?
4-(3,5-difluorophenyl)-5-(3-fluoro-4-methylsulfanylphenyl)-2,2-dimethylfuran-3-thione has a molecular weight of 380.46 g/mol, XLogP of 5.87, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-difluorophenyl)-5-(3-fluoro-4-methylsulfanylphenyl)-2,2-dimethylfuran-3-thione is sourced from PubChem (CID 18385763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).