About 4-(3,5-difluorophenyl)-5-(3-fluoro-4-methylsulfonylphenyl)-2,2-dimethylfuran-3-thione
4-(3,5-difluorophenyl)-5-(3-fluoro-4-methylsulfonylphenyl)-2,2-dimethylfuran-3-thione (PubChem CID 18386022) has the molecular formula C19H15F3O3S2
and a molecular weight of 412.45 g/mol. Its IUPAC name is 4-(3,5-difluorophenyl)-5-(3-fluoro-4-methylsulfonylphenyl)-2,2-dimethylfuran-3-thione.
Molecular Properties
| Compound Name | 4-(3,5-difluorophenyl)-5-(3-fluoro-4-methylsulfonylphenyl)-2,2-dimethylfuran-3-thione |
| PubChem CID | 18386022 |
| Molecular Formula | C19H15F3O3S2 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | 4-(3,5-difluorophenyl)-5-(3-fluoro-4-methylsulfonylphenyl)-2,2-dimethylfuran-3-thione |
| SMILES | CC1(C)OC(c2ccc(S(C)(=O)=O)c(F)c2)=C(c2cc(F)cc(F)c2)C1=S |
| InChI | InChI=1S/C19H15F3O3S2/c1-19(2)18(26)16(11-6-12(20)9-13(21)7-11)17(25-19)10-4-5-15(14(22)8-10)27(3,23)24/h4-9H,1-3H3 |
| InChIKey | ZICZBFZOXZMPNF-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,5-difluorophenyl)-5-(3-fluoro-4-methylsulfonylphenyl)-2,2-dimethylfuran-3-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,5-difluorophenyl)-5-(3-fluoro-4-methylsulfonylphenyl)-2,2-dimethylfuran-3-thione?
The IUPAC name of 4-(3,5-difluorophenyl)-5-(3-fluoro-4-methylsulfonylphenyl)-2,2-dimethylfuran-3-thione (CID 18386022) is 4-(3,5-difluorophenyl)-5-(3-fluoro-4-methylsulfonylphenyl)-2,2-dimethylfuran-3-thione.
What is the SMILES notation for 4-(3,5-difluorophenyl)-5-(3-fluoro-4-methylsulfonylphenyl)-2,2-dimethylfuran-3-thione?
The canonical SMILES for 4-(3,5-difluorophenyl)-5-(3-fluoro-4-methylsulfonylphenyl)-2,2-dimethylfuran-3-thione is CC1(C)OC(c2ccc(S(C)(=O)=O)c(F)c2)=C(c2cc(F)cc(F)c2)C1=S.
What is the InChIKey of 4-(3,5-difluorophenyl)-5-(3-fluoro-4-methylsulfonylphenyl)-2,2-dimethylfuran-3-thione?
The InChIKey is ZICZBFZOXZMPNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15F3O3S2/c1-19(2)18(26)16(11-6-12(20)9-13(21)7-11)17(25-19)10-4-5-15(14(22)8-10)27(3,23)24/h4-9H,1-3H3.
What are the key properties of 4-(3,5-difluorophenyl)-5-(3-fluoro-4-methylsulfonylphenyl)-2,2-dimethylfuran-3-thione?
4-(3,5-difluorophenyl)-5-(3-fluoro-4-methylsulfonylphenyl)-2,2-dimethylfuran-3-thione has a molecular weight of 412.45 g/mol, XLogP of 4.55, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-difluorophenyl)-5-(3-fluoro-4-methylsulfonylphenyl)-2,2-dimethylfuran-3-thione is sourced from PubChem (CID 18386022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).