About 4-(4-chlorophenyl)-5-(3-fluoro-4-methylsulfinylphenyl)-2,2-dimethylfuran-3-one
4-(4-chlorophenyl)-5-(3-fluoro-4-methylsulfinylphenyl)-2,2-dimethylfuran-3-one (PubChem CID 18386031) has the molecular formula C19H16ClFO3S
and a molecular weight of 378.85 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-5-(3-fluoro-4-methylsulfinylphenyl)-2,2-dimethylfuran-3-one.
Molecular Properties
| Compound Name | 4-(4-chlorophenyl)-5-(3-fluoro-4-methylsulfinylphenyl)-2,2-dimethylfuran-3-one |
| PubChem CID | 18386031 |
| Molecular Formula | C19H16ClFO3S |
| Molecular Weight | 378.85 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | 4-(4-chlorophenyl)-5-(3-fluoro-4-methylsulfinylphenyl)-2,2-dimethylfuran-3-one |
| SMILES | CS(=O)c1ccc(C2=C(c3ccc(Cl)cc3)C(=O)C(C)(C)O2)cc1F |
| InChI | InChI=1S/C19H16ClFO3S/c1-19(2)18(22)16(11-4-7-13(20)8-5-11)17(24-19)12-6-9-15(25(3)23)14(21)10-12/h4-10H,1-3H3 |
| InChIKey | NSFNPIWCQRAQPE-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.85 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-chlorophenyl)-5-(3-fluoro-4-methylsulfinylphenyl)-2,2-dimethylfuran-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-chlorophenyl)-5-(3-fluoro-4-methylsulfinylphenyl)-2,2-dimethylfuran-3-one?
The IUPAC name of 4-(4-chlorophenyl)-5-(3-fluoro-4-methylsulfinylphenyl)-2,2-dimethylfuran-3-one (CID 18386031) is 4-(4-chlorophenyl)-5-(3-fluoro-4-methylsulfinylphenyl)-2,2-dimethylfuran-3-one.
What is the SMILES notation for 4-(4-chlorophenyl)-5-(3-fluoro-4-methylsulfinylphenyl)-2,2-dimethylfuran-3-one?
The canonical SMILES for 4-(4-chlorophenyl)-5-(3-fluoro-4-methylsulfinylphenyl)-2,2-dimethylfuran-3-one is CS(=O)c1ccc(C2=C(c3ccc(Cl)cc3)C(=O)C(C)(C)O2)cc1F.
What is the InChIKey of 4-(4-chlorophenyl)-5-(3-fluoro-4-methylsulfinylphenyl)-2,2-dimethylfuran-3-one?
The InChIKey is NSFNPIWCQRAQPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16ClFO3S/c1-19(2)18(22)16(11-4-7-13(20)8-5-11)17(24-19)12-6-9-15(25(3)23)14(21)10-12/h4-10H,1-3H3.
What are the key properties of 4-(4-chlorophenyl)-5-(3-fluoro-4-methylsulfinylphenyl)-2,2-dimethylfuran-3-one?
4-(4-chlorophenyl)-5-(3-fluoro-4-methylsulfinylphenyl)-2,2-dimethylfuran-3-one has a molecular weight of 378.85 g/mol, XLogP of 4.46, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-chlorophenyl)-5-(3-fluoro-4-methylsulfinylphenyl)-2,2-dimethylfuran-3-one is sourced from PubChem (CID 18386031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).