About 4-[3-(2,4-dimethoxyphenyl)-5,5-dimethyl-4-oxofuran-2-yl]benzenesulfonamide
4-[3-(2,4-dimethoxyphenyl)-5,5-dimethyl-4-oxofuran-2-yl]benzenesulfonamide (PubChem CID 18386106) has the molecular formula C20H21NO6S
and a molecular weight of 403.46 g/mol. Its IUPAC name is 4-[3-(2,4-dimethoxyphenyl)-5,5-dimethyl-4-oxofuran-2-yl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[3-(2,4-dimethoxyphenyl)-5,5-dimethyl-4-oxofuran-2-yl]benzenesulfonamide |
| PubChem CID | 18386106 |
| Molecular Formula | C20H21NO6S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 4-[3-(2,4-dimethoxyphenyl)-5,5-dimethyl-4-oxofuran-2-yl]benzenesulfonamide |
| SMILES | COc1ccc(C2=C(c3ccc(S(N)(=O)=O)cc3)OC(C)(C)C2=O)c(OC)c1 |
| InChI | InChI=1S/C20H21NO6S/c1-20(2)19(22)17(15-10-7-13(25-3)11-16(15)26-4)18(27-20)12-5-8-14(9-6-12)28(21,23)24/h5-11H,1-4H3,(H2,21,23,24) |
| InChIKey | KLYNGVRDHRMQLW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-(2,4-dimethoxyphenyl)-5,5-dimethyl-4-oxofuran-2-yl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(2,4-dimethoxyphenyl)-5,5-dimethyl-4-oxofuran-2-yl]benzenesulfonamide?
The IUPAC name of 4-[3-(2,4-dimethoxyphenyl)-5,5-dimethyl-4-oxofuran-2-yl]benzenesulfonamide (CID 18386106) is 4-[3-(2,4-dimethoxyphenyl)-5,5-dimethyl-4-oxofuran-2-yl]benzenesulfonamide.
What is the SMILES notation for 4-[3-(2,4-dimethoxyphenyl)-5,5-dimethyl-4-oxofuran-2-yl]benzenesulfonamide?
The canonical SMILES for 4-[3-(2,4-dimethoxyphenyl)-5,5-dimethyl-4-oxofuran-2-yl]benzenesulfonamide is COc1ccc(C2=C(c3ccc(S(N)(=O)=O)cc3)OC(C)(C)C2=O)c(OC)c1.
What is the InChIKey of 4-[3-(2,4-dimethoxyphenyl)-5,5-dimethyl-4-oxofuran-2-yl]benzenesulfonamide?
The InChIKey is KLYNGVRDHRMQLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21NO6S/c1-20(2)19(22)17(15-10-7-13(25-3)11-16(15)26-4)18(27-20)12-5-8-14(9-6-12)28(21,23)24/h5-11H,1-4H3,(H2,21,23,24).
What are the key properties of 4-[3-(2,4-dimethoxyphenyl)-5,5-dimethyl-4-oxofuran-2-yl]benzenesulfonamide?
4-[3-(2,4-dimethoxyphenyl)-5,5-dimethyl-4-oxofuran-2-yl]benzenesulfonamide has a molecular weight of 403.46 g/mol, XLogP of 2.60, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(2,4-dimethoxyphenyl)-5,5-dimethyl-4-oxofuran-2-yl]benzenesulfonamide is sourced from PubChem (CID 18386106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).