About 4-(4-fluorophenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-thione
4-(4-fluorophenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-thione (PubChem CID 18386164) has the molecular formula C19H17FO3S2
and a molecular weight of 376.47 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-thione.
Molecular Properties
| Compound Name | 4-(4-fluorophenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-thione |
| PubChem CID | 18386164 |
| Molecular Formula | C19H17FO3S2 |
| Molecular Weight | 376.47 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 4-(4-fluorophenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-thione |
| SMILES | CC1(C)OC(c2ccc(S(C)(=O)=O)cc2)=C(c2ccc(F)cc2)C1=S |
| InChI | InChI=1S/C19H17FO3S2/c1-19(2)18(24)16(12-4-8-14(20)9-5-12)17(23-19)13-6-10-15(11-7-13)25(3,21)22/h4-11H,1-3H3 |
| InChIKey | WRILMNLMQIADBV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-fluorophenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-fluorophenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-thione?
The IUPAC name of 4-(4-fluorophenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-thione (CID 18386164) is 4-(4-fluorophenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-thione.
What is the SMILES notation for 4-(4-fluorophenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-thione?
The canonical SMILES for 4-(4-fluorophenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-thione is CC1(C)OC(c2ccc(S(C)(=O)=O)cc2)=C(c2ccc(F)cc2)C1=S.
What is the InChIKey of 4-(4-fluorophenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-thione?
The InChIKey is WRILMNLMQIADBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17FO3S2/c1-19(2)18(24)16(12-4-8-14(20)9-5-12)17(23-19)13-6-10-15(11-7-13)25(3,21)22/h4-11H,1-3H3.
What are the key properties of 4-(4-fluorophenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-thione?
4-(4-fluorophenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-thione has a molecular weight of 376.47 g/mol, XLogP of 4.28, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-fluorophenyl)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-thione is sourced from PubChem (CID 18386164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).