About 2-[4-(2-benzoyl-4-methoxy-5-propan-2-ylphenoxy)-3,5-dibromophenyl]acetic acid
2-[4-(2-benzoyl-4-methoxy-5-propan-2-ylphenoxy)-3,5-dibromophenyl]acetic acid (PubChem CID 18386352) has the molecular formula C25H22Br2O5
and a molecular weight of 562.25 g/mol. Its IUPAC name is 2-[4-(2-benzoyl-4-methoxy-5-propan-2-ylphenoxy)-3,5-dibromophenyl]acetic acid.
Molecular Properties
| Compound Name | 2-[4-(2-benzoyl-4-methoxy-5-propan-2-ylphenoxy)-3,5-dibromophenyl]acetic acid |
| PubChem CID | 18386352 |
| Molecular Formula | C25H22Br2O5 |
| Molecular Weight | 562.25 g/mol |
| Exact Mass | 559.98 |
| IUPAC Name | 2-[4-(2-benzoyl-4-methoxy-5-propan-2-ylphenoxy)-3,5-dibromophenyl]acetic acid |
| SMILES | COc1cc(C(=O)c2ccccc2)c(Oc2c(Br)cc(CC(=O)O)cc2Br)cc1C(C)C |
| InChI | InChI=1S/C25H22Br2O5/c1-14(2)17-12-22(32-25-19(26)9-15(10-20(25)27)11-23(28)29)18(13-21(17)31-3)24(30)16-7-5-4-6-8-16/h4-10,12-14H,11H2,1-3H3,(H,28,29) |
| InChIKey | MGCWUVKZLHSFCJ-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 562.25 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-(2-benzoyl-4-methoxy-5-propan-2-ylphenoxy)-3,5-dibromophenyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2-benzoyl-4-methoxy-5-propan-2-ylphenoxy)-3,5-dibromophenyl]acetic acid?
The IUPAC name of 2-[4-(2-benzoyl-4-methoxy-5-propan-2-ylphenoxy)-3,5-dibromophenyl]acetic acid (CID 18386352) is 2-[4-(2-benzoyl-4-methoxy-5-propan-2-ylphenoxy)-3,5-dibromophenyl]acetic acid.
What is the SMILES notation for 2-[4-(2-benzoyl-4-methoxy-5-propan-2-ylphenoxy)-3,5-dibromophenyl]acetic acid?
The canonical SMILES for 2-[4-(2-benzoyl-4-methoxy-5-propan-2-ylphenoxy)-3,5-dibromophenyl]acetic acid is COc1cc(C(=O)c2ccccc2)c(Oc2c(Br)cc(CC(=O)O)cc2Br)cc1C(C)C.
What is the InChIKey of 2-[4-(2-benzoyl-4-methoxy-5-propan-2-ylphenoxy)-3,5-dibromophenyl]acetic acid?
The InChIKey is MGCWUVKZLHSFCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22Br2O5/c1-14(2)17-12-22(32-25-19(26)9-15(10-20(25)27)11-23(28)29)18(13-21(17)31-3)24(30)16-7-5-4-6-8-16/h4-10,12-14H,11H2,1-3H3,(H,28,29).
What are the key properties of 2-[4-(2-benzoyl-4-methoxy-5-propan-2-ylphenoxy)-3,5-dibromophenyl]acetic acid?
2-[4-(2-benzoyl-4-methoxy-5-propan-2-ylphenoxy)-3,5-dibromophenyl]acetic acid has a molecular weight of 562.25 g/mol, XLogP of 6.99, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2-benzoyl-4-methoxy-5-propan-2-ylphenoxy)-3,5-dibromophenyl]acetic acid is sourced from PubChem (CID 18386352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).