About 7-chloro-4-methoxy-N,N-dimethyl-2,3-dihydro-1H-inden-1-amine
7-chloro-4-methoxy-N,N-dimethyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 18386395) has the molecular formula C12H16ClNO
and a molecular weight of 225.72 g/mol. Its IUPAC name is 7-chloro-4-methoxy-N,N-dimethyl-2,3-dihydro-1H-inden-1-amine.
Molecular Properties
| Compound Name | 7-chloro-4-methoxy-N,N-dimethyl-2,3-dihydro-1H-inden-1-amine |
| PubChem CID | 18386395 |
| Molecular Formula | C12H16ClNO |
| Molecular Weight | 225.72 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 7-chloro-4-methoxy-N,N-dimethyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | COc1ccc(Cl)c2c1CCC2N(C)C |
| InChI | InChI=1S/C12H16ClNO/c1-14(2)10-6-4-8-11(15-3)7-5-9(13)12(8)10/h5,7,10H,4,6H2,1-3H3 |
| InChIKey | DFOWLVFXVQIGQP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.72 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-chloro-4-methoxy-N,N-dimethyl-2,3-dihydro-1H-inden-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-4-methoxy-N,N-dimethyl-2,3-dihydro-1H-inden-1-amine?
The IUPAC name of 7-chloro-4-methoxy-N,N-dimethyl-2,3-dihydro-1H-inden-1-amine (CID 18386395) is 7-chloro-4-methoxy-N,N-dimethyl-2,3-dihydro-1H-inden-1-amine.
What is the SMILES notation for 7-chloro-4-methoxy-N,N-dimethyl-2,3-dihydro-1H-inden-1-amine?
The canonical SMILES for 7-chloro-4-methoxy-N,N-dimethyl-2,3-dihydro-1H-inden-1-amine is COc1ccc(Cl)c2c1CCC2N(C)C.
What is the InChIKey of 7-chloro-4-methoxy-N,N-dimethyl-2,3-dihydro-1H-inden-1-amine?
The InChIKey is DFOWLVFXVQIGQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16ClNO/c1-14(2)10-6-4-8-11(15-3)7-5-9(13)12(8)10/h5,7,10H,4,6H2,1-3H3.
What are the key properties of 7-chloro-4-methoxy-N,N-dimethyl-2,3-dihydro-1H-inden-1-amine?
7-chloro-4-methoxy-N,N-dimethyl-2,3-dihydro-1H-inden-1-amine has a molecular weight of 225.72 g/mol, XLogP of 2.90, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-4-methoxy-N,N-dimethyl-2,3-dihydro-1H-inden-1-amine is sourced from PubChem (CID 18386395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).