About N',N'-dihydroxyethane-1,2-diamine
N',N'-dihydroxyethane-1,2-diamine (PubChem CID 18386450) has the molecular formula C2H8N2O2
and a molecular weight of 92.10 g/mol. Its IUPAC name is N',N'-dihydroxyethane-1,2-diamine.
Molecular Properties
| Compound Name | N',N'-dihydroxyethane-1,2-diamine |
| PubChem CID | 18386450 |
| Molecular Formula | C2H8N2O2 |
| Molecular Weight | 92.10 g/mol |
| Exact Mass | 92.06 |
| IUPAC Name | N',N'-dihydroxyethane-1,2-diamine |
| SMILES | NCCN(O)O |
| InChI | InChI=1S/C2H8N2O2/c3-1-2-4(5)6/h5-6H,1-3H2 |
| InChIKey | VPPZZYUKSCTNNZ-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 92.10 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N',N'-dihydroxyethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',N'-dihydroxyethane-1,2-diamine?
The IUPAC name of N',N'-dihydroxyethane-1,2-diamine (CID 18386450) is N',N'-dihydroxyethane-1,2-diamine.
What is the SMILES notation for N',N'-dihydroxyethane-1,2-diamine?
The canonical SMILES for N',N'-dihydroxyethane-1,2-diamine is NCCN(O)O.
What is the InChIKey of N',N'-dihydroxyethane-1,2-diamine?
The InChIKey is VPPZZYUKSCTNNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H8N2O2/c3-1-2-4(5)6/h5-6H,1-3H2.
What are the key properties of N',N'-dihydroxyethane-1,2-diamine?
N',N'-dihydroxyethane-1,2-diamine has a molecular weight of 92.10 g/mol, XLogP of -0.97, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N',N'-dihydroxyethane-1,2-diamine is sourced from PubChem (CID 18386450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).