C17H18ClF3N2O3 — CID 18386564
tert-butyl N-[6-chloro-4-(4-cyclopropyl-1,1,1-trifluoro-2-hydroxybut-3-yn-2-yl)-3-pyridinyl]carbamate (PubChem CID 18386564) has the molecular formula C17H18ClF3N2O3 and a molecular weight of 390.79 g/mol. Its IUPAC name is tert-butyl N-[6-chloro-4-(4-cyclopropyl-1,1,1-trifluoro-2-hydroxybut-3-yn-2-yl)-3-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[6-chloro-4-(4-cyclopropyl-1,1,1-trifluoro-2-hydroxybut-3-yn-2-yl)-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 18386564 |
| Molecular Formula | C17H18ClF3N2O3 |
| Molecular Weight | 390.79 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | tert-butyl N-[6-chloro-4-(4-cyclopropyl-1,1,1-trifluoro-2-hydroxybut-3-yn-2-yl)-3-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cnc(Cl)cc1C(O)(C#CC1CC1)C(F)(F)F |
| InChI | InChI=1S/C17H18ClF3N2O3/c1-15(2,3)26-14(24)23-12-9-22-13(18)8-11(12)16(25,17(19,20)21)7-6-10-4-5-10/h8-10,25H,4-5H2,1-3H3,(H,23,24) |
| InChIKey | YLIBYEXRDQYBGM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.79 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|