C13H12N4O4 — CID 18386981
1H-1,4-benzodiazepine-2,5-dione;piperazine-2,3-dione (PubChem CID 18386981) has the molecular formula C13H12N4O4 and a molecular weight of 288.26 g/mol. Its IUPAC name is 1H-1,4-benzodiazepine-2,5-dione;piperazine-2,3-dione.
| Compound Name | 1H-1,4-benzodiazepine-2,5-dione;piperazine-2,3-dione |
|---|---|
| PubChem CID | 18386981 |
| Molecular Formula | C13H12N4O4 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 1H-1,4-benzodiazepine-2,5-dione;piperazine-2,3-dione |
| SMILES | O=C1NCCNC1=O.O=c1cnc(=O)c2ccccc2[nH]1 |
| InChI | InChI=1S/C9H6N2O2.C4H6N2O2/c12-8-5-10-9(13)6-3-1-2-4-7(6)11-8;7-3-4(8)6-2-1-5-3/h1-5H,(H,11,12);1-2H2,(H,5,7)(H,6,8) |
| InChIKey | SPOMPLYRJLIKTB-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 121.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|