About [nitro(phenyl)methyl] dihydrogen phosphate
[nitro(phenyl)methyl] dihydrogen phosphate (PubChem CID 18387126) has the molecular formula C7H8NO6P
and a molecular weight of 233.12 g/mol. Its IUPAC name is [nitro(phenyl)methyl] dihydrogen phosphate.
Molecular Properties
| Compound Name | [nitro(phenyl)methyl] dihydrogen phosphate |
| PubChem CID | 18387126 |
| Molecular Formula | C7H8NO6P |
| Molecular Weight | 233.12 g/mol |
| Exact Mass | 233.01 |
| IUPAC Name | [nitro(phenyl)methyl] dihydrogen phosphate |
| SMILES | O=[N+]([O-])C(OP(=O)(O)O)c1ccccc1 |
| InChI | InChI=1S/C7H8NO6P/c9-8(10)7(14-15(11,12)13)6-4-2-1-3-5-6/h1-5,7H,(H2,11,12,13) |
| InChIKey | MVWJVRYXENKVCF-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.12 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [nitro(phenyl)methyl] dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [nitro(phenyl)methyl] dihydrogen phosphate?
The IUPAC name of [nitro(phenyl)methyl] dihydrogen phosphate (CID 18387126) is [nitro(phenyl)methyl] dihydrogen phosphate.
What is the SMILES notation for [nitro(phenyl)methyl] dihydrogen phosphate?
The canonical SMILES for [nitro(phenyl)methyl] dihydrogen phosphate is O=[N+]([O-])C(OP(=O)(O)O)c1ccccc1.
What is the InChIKey of [nitro(phenyl)methyl] dihydrogen phosphate?
The InChIKey is MVWJVRYXENKVCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8NO6P/c9-8(10)7(14-15(11,12)13)6-4-2-1-3-5-6/h1-5,7H,(H2,11,12,13).
What are the key properties of [nitro(phenyl)methyl] dihydrogen phosphate?
[nitro(phenyl)methyl] dihydrogen phosphate has a molecular weight of 233.12 g/mol, XLogP of 1.07, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [nitro(phenyl)methyl] dihydrogen phosphate is sourced from PubChem (CID 18387126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).