About 7-chloro-5-(2-pyridin-3-ylethynyl)-5-(trifluoromethyl)-1H-4,1-benzoxazepin-2-one
7-chloro-5-(2-pyridin-3-ylethynyl)-5-(trifluoromethyl)-1H-4,1-benzoxazepin-2-one (PubChem CID 18387402) has the molecular formula C17H10ClF3N2O2
and a molecular weight of 366.73 g/mol. Its IUPAC name is 7-chloro-5-(2-pyridin-3-ylethynyl)-5-(trifluoromethyl)-1H-4,1-benzoxazepin-2-one.
Molecular Properties
| Compound Name | 7-chloro-5-(2-pyridin-3-ylethynyl)-5-(trifluoromethyl)-1H-4,1-benzoxazepin-2-one |
| PubChem CID | 18387402 |
| Molecular Formula | C17H10ClF3N2O2 |
| Molecular Weight | 366.73 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | 7-chloro-5-(2-pyridin-3-ylethynyl)-5-(trifluoromethyl)-1H-4,1-benzoxazepin-2-one |
| SMILES | O=C1COC(C#Cc2cccnc2)(C(F)(F)F)c2cc(Cl)ccc2N1 |
| InChI | InChI=1S/C17H10ClF3N2O2/c18-12-3-4-14-13(8-12)16(17(19,20)21,25-10-15(24)23-14)6-5-11-2-1-7-22-9-11/h1-4,7-9H,10H2,(H,23,24) |
| InChIKey | QACTVSADKHGKOD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.73 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-5-(2-pyridin-3-ylethynyl)-5-(trifluoromethyl)-1H-4,1-benzoxazepin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-5-(2-pyridin-3-ylethynyl)-5-(trifluoromethyl)-1H-4,1-benzoxazepin-2-one?
The IUPAC name of 7-chloro-5-(2-pyridin-3-ylethynyl)-5-(trifluoromethyl)-1H-4,1-benzoxazepin-2-one (CID 18387402) is 7-chloro-5-(2-pyridin-3-ylethynyl)-5-(trifluoromethyl)-1H-4,1-benzoxazepin-2-one.
What is the SMILES notation for 7-chloro-5-(2-pyridin-3-ylethynyl)-5-(trifluoromethyl)-1H-4,1-benzoxazepin-2-one?
The canonical SMILES for 7-chloro-5-(2-pyridin-3-ylethynyl)-5-(trifluoromethyl)-1H-4,1-benzoxazepin-2-one is O=C1COC(C#Cc2cccnc2)(C(F)(F)F)c2cc(Cl)ccc2N1.
What is the InChIKey of 7-chloro-5-(2-pyridin-3-ylethynyl)-5-(trifluoromethyl)-1H-4,1-benzoxazepin-2-one?
The InChIKey is QACTVSADKHGKOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10ClF3N2O2/c18-12-3-4-14-13(8-12)16(17(19,20)21,25-10-15(24)23-14)6-5-11-2-1-7-22-9-11/h1-4,7-9H,10H2,(H,23,24).
What are the key properties of 7-chloro-5-(2-pyridin-3-ylethynyl)-5-(trifluoromethyl)-1H-4,1-benzoxazepin-2-one?
7-chloro-5-(2-pyridin-3-ylethynyl)-5-(trifluoromethyl)-1H-4,1-benzoxazepin-2-one has a molecular weight of 366.73 g/mol, XLogP of 3.51, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-5-(2-pyridin-3-ylethynyl)-5-(trifluoromethyl)-1H-4,1-benzoxazepin-2-one is sourced from PubChem (CID 18387402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).