About 8-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methylsulfanyl-3-propyl-7H-purin-2-one
8-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methylsulfanyl-3-propyl-7H-purin-2-one (PubChem CID 18387992) has the molecular formula C14H17N5O2S
and a molecular weight of 319.39 g/mol. Its IUPAC name is 8-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methylsulfanyl-3-propyl-7H-purin-2-one.
Molecular Properties
| Compound Name | 8-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methylsulfanyl-3-propyl-7H-purin-2-one |
| PubChem CID | 18387992 |
| Molecular Formula | C14H17N5O2S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 8-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methylsulfanyl-3-propyl-7H-purin-2-one |
| SMILES | CCCn1c(=O)nc(SC)c2[nH]c(-c3c(C)noc3C)nc21 |
| InChI | InChI=1S/C14H17N5O2S/c1-5-6-19-12-10(13(22-4)17-14(19)20)15-11(16-12)9-7(2)18-21-8(9)3/h5-6H2,1-4H3,(H,15,16) |
| InChIKey | HLWPYFGBSIHXEY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 8-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methylsulfanyl-3-propyl-7H-purin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methylsulfanyl-3-propyl-7H-purin-2-one?
The IUPAC name of 8-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methylsulfanyl-3-propyl-7H-purin-2-one (CID 18387992) is 8-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methylsulfanyl-3-propyl-7H-purin-2-one.
What is the SMILES notation for 8-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methylsulfanyl-3-propyl-7H-purin-2-one?
The canonical SMILES for 8-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methylsulfanyl-3-propyl-7H-purin-2-one is CCCn1c(=O)nc(SC)c2[nH]c(-c3c(C)noc3C)nc21.
What is the InChIKey of 8-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methylsulfanyl-3-propyl-7H-purin-2-one?
The InChIKey is HLWPYFGBSIHXEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N5O2S/c1-5-6-19-12-10(13(22-4)17-14(19)20)15-11(16-12)9-7(2)18-21-8(9)3/h5-6H2,1-4H3,(H,15,16).
What are the key properties of 8-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methylsulfanyl-3-propyl-7H-purin-2-one?
8-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methylsulfanyl-3-propyl-7H-purin-2-one has a molecular weight of 319.39 g/mol, XLogP of 2.52, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methylsulfanyl-3-propyl-7H-purin-2-one is sourced from PubChem (CID 18387992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).