C37H34F3N3O6 — CID 18388461
[2-[3-[3-(1,1-diphenylethyl)-4-hydroxy-5-[5-(trifluoromethyl)benzotriazol-2-yl]phenyl]propanoyloxy]-3-hydroxypropyl] 2-methylprop-2-enoate (PubChem CID 18388461) has the molecular formula C37H34F3N3O6 and a molecular weight of 673.69 g/mol. Its IUPAC name is [2-[3-[3-(1,1-diphenylethyl)-4-hydroxy-5-[5-(trifluoromethyl)benzotriazol-2-yl]phenyl]propanoyloxy]-3-hydroxypropyl] 2-methylprop-2-enoate.
| Compound Name | [2-[3-[3-(1,1-diphenylethyl)-4-hydroxy-5-[5-(trifluoromethyl)benzotriazol-2-yl]phenyl]propanoyloxy]-3-hydroxypropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 18388461 |
| Molecular Formula | C37H34F3N3O6 |
| Molecular Weight | 673.69 g/mol |
| Exact Mass | 673.24 |
| IUPAC Name | [2-[3-[3-(1,1-diphenylethyl)-4-hydroxy-5-[5-(trifluoromethyl)benzotriazol-2-yl]phenyl]propanoyloxy]-3-hydroxypropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CO)OC(=O)CCc1cc(-n2nc3ccc(C(F)(F)F)cc3n2)c(O)c(C(C)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C37H34F3N3O6/c1-23(2)35(47)48-22-28(21-44)49-33(45)17-14-24-18-29(36(3,25-10-6-4-7-11-25)26-12-8-5-9-13-26)34(46)32(19-24)43-41-30-16-15-27(37(38,39)40)20-31(30)42-43/h4-13,15-16,18-20,28,44,46H,1,14,17,21-22H2,2-3H3 |
| InChIKey | DDMXLPFJVLMKEH-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 123.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.69 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|