C17H10F12N2 — CID 18388526
4-[2-[4-amino-3-(trifluoromethyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(trifluoromethyl)aniline (PubChem CID 18388526) has the molecular formula C17H10F12N2 and a molecular weight of 470.26 g/mol. Its IUPAC name is 4-[2-[4-amino-3-(trifluoromethyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(trifluoromethyl)aniline.
| Compound Name | 4-[2-[4-amino-3-(trifluoromethyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 18388526 |
| Molecular Formula | C17H10F12N2 |
| Molecular Weight | 470.26 g/mol |
| Exact Mass | 470.07 |
| IUPAC Name | 4-[2-[4-amino-3-(trifluoromethyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(trifluoromethyl)aniline |
| SMILES | Nc1ccc(C(c2ccc(N)c(C(F)(F)F)c2)(C(F)(F)F)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C17H10F12N2/c18-14(19,20)9-5-7(1-3-11(9)30)13(16(24,25)26,17(27,28)29)8-2-4-12(31)10(6-8)15(21,22)23/h1-6H,30-31H2 |
| InChIKey | ZPSPCHXHMKVRQK-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.26 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|