C13H23F6N — CID 18388691
N-butyl-1,1,2,2,3,3-hexafluorononan-1-amine (PubChem CID 18388691) has the molecular formula C13H23F6N and a molecular weight of 307.32 g/mol. Its IUPAC name is N-butyl-1,1,2,2,3,3-hexafluorononan-1-amine.
| Compound Name | N-butyl-1,1,2,2,3,3-hexafluorononan-1-amine |
|---|---|
| PubChem CID | 18388691 |
| Molecular Formula | C13H23F6N |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | N-butyl-1,1,2,2,3,3-hexafluorononan-1-amine |
| SMILES | CCCCCCC(F)(F)C(F)(F)C(F)(F)NCCCC |
| InChI | InChI=1S/C13H23F6N/c1-3-5-7-8-9-11(14,15)12(16,17)13(18,19)20-10-6-4-2/h20H,3-10H2,1-2H3 |
| InChIKey | IATSQMBPQMVLQA-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|