C20H16F3N3O2 — CID 18389474
(1R,2R,6S,7R)-4-[1-methyl-4-phenyl-3-(trifluoromethyl)pyrazol-5-yl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 18389474) has the molecular formula C20H16F3N3O2 and a molecular weight of 387.36 g/mol. Its IUPAC name is (1R,2R,6S,7R)-4-[1-methyl-4-phenyl-3-(trifluoromethyl)pyrazol-5-yl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2R,6S,7R)-4-[1-methyl-4-phenyl-3-(trifluoromethyl)pyrazol-5-yl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 18389474 |
| Molecular Formula | C20H16F3N3O2 |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | (1R,2R,6S,7R)-4-[1-methyl-4-phenyl-3-(trifluoromethyl)pyrazol-5-yl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | Cn1nc(C(F)(F)F)c(-c2ccccc2)c1N1C(=O)[C@@H]2[C@H](C1=O)[C@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C20H16F3N3O2/c1-25-17(15(10-5-3-2-4-6-10)16(24-25)20(21,22)23)26-18(27)13-11-7-8-12(9-11)14(13)19(26)28/h2-8,11-14H,9H2,1H3/t11-,12-,13-,14+/m0/s1 |
| InChIKey | HIAGULHIIKOHRY-XDQVBPFNSA-N |
| XLogP | 3.42 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|