C14H26N2+2 — CID 18389551
1-[[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-ethylpiperazine-1,4-diium (PubChem CID 18389551) has the molecular formula C14H26N2+2 and a molecular weight of 222.38 g/mol. Its IUPAC name is 1-[[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-ethylpiperazine-1,4-diium.
| Compound Name | 1-[[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-ethylpiperazine-1,4-diium |
|---|---|
| PubChem CID | 18389551 |
| Molecular Formula | C14H26N2+2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | 1-[[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-ethylpiperazine-1,4-diium |
| SMILES | CC[NH+]1CC[NH+](C[C@H]2C[C@H]3C=C[C@@H]2C3)CC1 |
| InChI | InChI=1S/C14H24N2/c1-2-15-5-7-16(8-6-15)11-14-10-12-3-4-13(14)9-12/h3-4,12-14H,2,5-11H2,1H3/p+2/t12-,13+,14+/m0/s1 |
| InChIKey | PDGVEKQRRLWLAS-BFHYXJOUSA-P |
| XLogP | -1.00 |
| TPSA | 8.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|