C14H16Br2NO4S- — CID 18389612
(2R)-2-[(1R,2S,6R,7S,8R,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-4-methylsulfanylbutanoate (PubChem CID 18389612) has the molecular formula C14H16Br2NO4S- and a molecular weight of 454.16 g/mol. Its IUPAC name is (2R)-2-[(1R,2S,6R,7S,8R,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-4-methylsulfanylbutanoate.
| Compound Name | (2R)-2-[(1R,2S,6R,7S,8R,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 18389612 |
| Molecular Formula | C14H16Br2NO4S- |
| Molecular Weight | 454.16 g/mol |
| Exact Mass | 451.92 |
| IUPAC Name | (2R)-2-[(1R,2S,6R,7S,8R,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@H](C(=O)[O-])N1C(=O)[C@@H]2[C@H]3C[C@H]([C@@H](Br)[C@@H]3Br)[C@@H]2C1=O |
| InChI | InChI=1S/C14H17Br2NO4S/c1-22-3-2-7(14(20)21)17-12(18)8-5-4-6(9(8)13(17)19)11(16)10(5)15/h5-11H,2-4H2,1H3,(H,20,21)/p-1/t5-,6+,7-,8-,9+,10-,11-/m1/s1 |
| InChIKey | OFWVXUGPCJUTIZ-QORADQBASA-M |
| XLogP | 0.64 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.16 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|