C17H17BrO4 — CID 18389738
5-[(1S,3S,5R,6S,7R,9R,10S,11R)-11-bromo-8-pentacyclo[5.4.0.02,6.03,10.05,9]undecanylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 18389738) has the molecular formula C17H17BrO4 and a molecular weight of 365.22 g/mol. Its IUPAC name is 5-[(1S,3S,5R,6S,7R,9R,10S,11R)-11-bromo-8-pentacyclo[5.4.0.02,6.03,10.05,9]undecanylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(1S,3S,5R,6S,7R,9R,10S,11R)-11-bromo-8-pentacyclo[5.4.0.02,6.03,10.05,9]undecanylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 18389738 |
| Molecular Formula | C17H17BrO4 |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | 5-[(1S,3S,5R,6S,7R,9R,10S,11R)-11-bromo-8-pentacyclo[5.4.0.02,6.03,10.05,9]undecanylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=C2[C@@H]3[C@@H]4CC5C6[C@H]([C@H](Br)[C@@H]53)[C@H]2[C@H]64)C(=O)O1 |
| InChI | InChI=1S/C17H17BrO4/c1-17(2)21-15(19)13(16(20)22-17)11-8-4-3-5-7-6(4)10(11)12(7)14(18)9(5)8/h4-10,12,14H,3H2,1-2H3/t4-,5?,6+,7?,8-,9+,10+,12+,14-/m1/s1 |
| InChIKey | RJGIOBOOMIYNRD-UXQXNZQDSA-N |
| XLogP | 2.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|