C11H12F2O — CID 18389832
[(1S,2S,4R,5R,7R,8R,9R)-10,10-difluoro-2-pentacyclo[5.3.0.02,5.03,9.04,8]decanyl]methanol (PubChem CID 18389832) has the molecular formula C11H12F2O and a molecular weight of 198.21 g/mol. Its IUPAC name is [(1S,2S,4R,5R,7R,8R,9R)-10,10-difluoro-2-pentacyclo[5.3.0.02,5.03,9.04,8]decanyl]methanol.
| Compound Name | [(1S,2S,4R,5R,7R,8R,9R)-10,10-difluoro-2-pentacyclo[5.3.0.02,5.03,9.04,8]decanyl]methanol |
|---|---|
| PubChem CID | 18389832 |
| Molecular Formula | C11H12F2O |
| Molecular Weight | 198.21 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | [(1S,2S,4R,5R,7R,8R,9R)-10,10-difluoro-2-pentacyclo[5.3.0.02,5.03,9.04,8]decanyl]methanol |
| SMILES | OC[C@]12C3C4[C@H]5[C@@H](C[C@H]41)[C@@H]2C(F)(F)[C@@H]35 |
| InChI | InChI=1S/C11H12F2O/c12-11(13)8-5-3-1-4-6(5)7(8)10(4,2-14)9(3)11/h3-9,14H,1-2H2/t3-,4-,5-,6?,7?,8-,9+,10-/m1/s1 |
| InChIKey | ULBIMDJLUAJWTC-XHLROQQHSA-N |
| XLogP | 1.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.21 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |