C14H11FN2O6 — CID 18390161
(1R,2R,3S,4S)-3-[(4-fluoro-3-nitrophenyl)carbamoyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 18390161) has the molecular formula C14H11FN2O6 and a molecular weight of 322.25 g/mol. Its IUPAC name is (1R,2R,3S,4S)-3-[(4-fluoro-3-nitrophenyl)carbamoyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1R,2R,3S,4S)-3-[(4-fluoro-3-nitrophenyl)carbamoyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 18390161 |
| Molecular Formula | C14H11FN2O6 |
| Molecular Weight | 322.25 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | (1R,2R,3S,4S)-3-[(4-fluoro-3-nitrophenyl)carbamoyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1[C@H](C(=O)Nc2ccc(F)c([N+](=O)[O-])c2)[C@@H]2C=C[C@H]1O2 |
| InChI | InChI=1S/C14H11FN2O6/c15-7-2-1-6(5-8(7)17(21)22)16-13(18)11-9-3-4-10(23-9)12(11)14(19)20/h1-5,9-12H,(H,16,18)(H,19,20)/t9-,10+,11+,12-/m0/s1 |
| InChIKey | XGHKLCSMNZGIHH-QCNOEVLYSA-N |
| XLogP | 1.33 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.25 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|