C17H22NO4- — CID 18390635
(1S,5S,6S,7S)-3-[(2R)-6-methylhept-5-en-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate (PubChem CID 18390635) has the molecular formula C17H22NO4- and a molecular weight of 304.37 g/mol. Its IUPAC name is (1S,5S,6S,7S)-3-[(2R)-6-methylhept-5-en-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate.
| Compound Name | (1S,5S,6S,7S)-3-[(2R)-6-methylhept-5-en-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate |
|---|---|
| PubChem CID | 18390635 |
| Molecular Formula | C17H22NO4- |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | (1S,5S,6S,7S)-3-[(2R)-6-methylhept-5-en-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate |
| SMILES | CC(C)=CCC[C@@H](C)N1C[C@@]23C=C[C@H](O2)[C@@H](C(=O)[O-])[C@@H]3C1=O |
| InChI | InChI=1S/C17H23NO4/c1-10(2)5-4-6-11(3)18-9-17-8-7-12(22-17)13(16(20)21)14(17)15(18)19/h5,7-8,11-14H,4,6,9H2,1-3H3,(H,20,21)/p-1/t11-,12+,13-,14-,17-/m1/s1 |
| InChIKey | AYRGGDSIYYYSRA-QFRSUPTLSA-M |
| XLogP | 0.65 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|