C29H38O3S — CID 18391403
1-[(3R,5R,8R,9S,10S,13S,14S,17S)-3-[2-(5-acetylthiophen-2-yl)ethynyl]-3-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 18391403) has the molecular formula C29H38O3S and a molecular weight of 466.69 g/mol. Its IUPAC name is 1-[(3R,5R,8R,9S,10S,13S,14S,17S)-3-[2-(5-acetylthiophen-2-yl)ethynyl]-3-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 1-[(3R,5R,8R,9S,10S,13S,14S,17S)-3-[2-(5-acetylthiophen-2-yl)ethynyl]-3-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 18391403 |
| Molecular Formula | C29H38O3S |
| Molecular Weight | 466.69 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | 1-[(3R,5R,8R,9S,10S,13S,14S,17S)-3-[2-(5-acetylthiophen-2-yl)ethynyl]-3-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | CC(=O)c1ccc(C#C[C@@]2(O)CC[C@@]3(C)[C@H](CC[C@@H]4[C@@H]3CC[C@]3(C)[C@@H](C(C)=O)CC[C@@H]43)C2)s1 |
| InChI | InChI=1S/C29H38O3S/c1-18(30)23-8-9-24-22-7-5-20-17-29(32,14-11-21-6-10-26(33-21)19(2)31)16-15-27(20,3)25(22)12-13-28(23,24)4/h6,10,20,22-25,32H,5,7-9,12-13,15-17H2,1-4H3/t20-,22+,23-,24+,25+,27+,28-,29-/m1/s1 |
| InChIKey | GJUOIGSNPPHXLO-MORGGJAJSA-N |
| XLogP | 6.28 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.69 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|