C25H27NO4 — CID 18391443
ethyl (4aR,8aR)-2-benzyl-1,6-dioxo-4a-phenyl-3,4,5,7,8,8a-hexahydroisoquinoline-8-carboxylate (PubChem CID 18391443) has the molecular formula C25H27NO4 and a molecular weight of 405.49 g/mol. Its IUPAC name is ethyl (4aR,8aR)-2-benzyl-1,6-dioxo-4a-phenyl-3,4,5,7,8,8a-hexahydroisoquinoline-8-carboxylate.
| Compound Name | ethyl (4aR,8aR)-2-benzyl-1,6-dioxo-4a-phenyl-3,4,5,7,8,8a-hexahydroisoquinoline-8-carboxylate |
|---|---|
| PubChem CID | 18391443 |
| Molecular Formula | C25H27NO4 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | ethyl (4aR,8aR)-2-benzyl-1,6-dioxo-4a-phenyl-3,4,5,7,8,8a-hexahydroisoquinoline-8-carboxylate |
| SMILES | CCOC(=O)C1CC(=O)C[C@]2(c3ccccc3)CCN(Cc3ccccc3)C(=O)[C@H]12 |
| InChI | InChI=1S/C25H27NO4/c1-2-30-24(29)21-15-20(27)16-25(19-11-7-4-8-12-19)13-14-26(23(28)22(21)25)17-18-9-5-3-6-10-18/h3-12,21-22H,2,13-17H2,1H3/t21?,22-,25-/m0/s1 |
| InChIKey | XQEHNHAFMKLESZ-IJYFBAFXSA-N |
| XLogP | 3.52 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |