About (4S)-4-(3,4-dichlorophenyl)-N-methoxy-N-methylhept-6-enamide
(4S)-4-(3,4-dichlorophenyl)-N-methoxy-N-methylhept-6-enamide (PubChem CID 18392766) has the molecular formula C15H19Cl2NO2
and a molecular weight of 316.23 g/mol. Its IUPAC name is (4S)-4-(3,4-dichlorophenyl)-N-methoxy-N-methylhept-6-enamide.
Molecular Properties
| Compound Name | (4S)-4-(3,4-dichlorophenyl)-N-methoxy-N-methylhept-6-enamide |
| PubChem CID | 18392766 |
| Molecular Formula | C15H19Cl2NO2 |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | (4S)-4-(3,4-dichlorophenyl)-N-methoxy-N-methylhept-6-enamide |
| SMILES | C=CC[C@H](CCC(=O)N(C)OC)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H19Cl2NO2/c1-4-5-11(7-9-15(19)18(2)20-3)12-6-8-13(16)14(17)10-12/h4,6,8,10-11H,1,5,7,9H2,2-3H3/t11-/m1/s1 |
| InChIKey | YUXFVAZIMBXONB-LLVKDONJSA-N |
| XLogP | 4.45 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4S)-4-(3,4-dichlorophenyl)-N-methoxy-N-methylhept-6-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-(3,4-dichlorophenyl)-N-methoxy-N-methylhept-6-enamide?
The IUPAC name of (4S)-4-(3,4-dichlorophenyl)-N-methoxy-N-methylhept-6-enamide (CID 18392766) is (4S)-4-(3,4-dichlorophenyl)-N-methoxy-N-methylhept-6-enamide.
What is the SMILES notation for (4S)-4-(3,4-dichlorophenyl)-N-methoxy-N-methylhept-6-enamide?
The canonical SMILES for (4S)-4-(3,4-dichlorophenyl)-N-methoxy-N-methylhept-6-enamide is C=CC[C@H](CCC(=O)N(C)OC)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of (4S)-4-(3,4-dichlorophenyl)-N-methoxy-N-methylhept-6-enamide?
The InChIKey is YUXFVAZIMBXONB-LLVKDONJSA-N. The full InChI is InChI=1S/C15H19Cl2NO2/c1-4-5-11(7-9-15(19)18(2)20-3)12-6-8-13(16)14(17)10-12/h4,6,8,10-11H,1,5,7,9H2,2-3H3/t11-/m1/s1.
What are the key properties of (4S)-4-(3,4-dichlorophenyl)-N-methoxy-N-methylhept-6-enamide?
(4S)-4-(3,4-dichlorophenyl)-N-methoxy-N-methylhept-6-enamide has a molecular weight of 316.23 g/mol, XLogP of 4.45, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-(3,4-dichlorophenyl)-N-methoxy-N-methylhept-6-enamide is sourced from PubChem (CID 18392766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).