C21H27NO2 — CID 18392782
3,6-dimethyl-4-[(E)-pent-2-en-3-yl]oxy-2-(2,4,6-trimethylphenoxy)pyridine (PubChem CID 18392782) has the molecular formula C21H27NO2 and a molecular weight of 325.45 g/mol. Its IUPAC name is 3,6-dimethyl-4-[(E)-pent-2-en-3-yl]oxy-2-(2,4,6-trimethylphenoxy)pyridine.
| Compound Name | 3,6-dimethyl-4-[(E)-pent-2-en-3-yl]oxy-2-(2,4,6-trimethylphenoxy)pyridine |
|---|---|
| PubChem CID | 18392782 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 3,6-dimethyl-4-[(E)-pent-2-en-3-yl]oxy-2-(2,4,6-trimethylphenoxy)pyridine |
| SMILES | C/C=C(\CC)Oc1cc(C)nc(Oc2c(C)cc(C)cc2C)c1C |
| InChI | InChI=1S/C21H27NO2/c1-8-18(9-2)23-19-12-16(6)22-21(17(19)7)24-20-14(4)10-13(3)11-15(20)5/h8,10-12H,9H2,1-7H3/b18-8+ |
| InChIKey | NAKAGOOICRJDFB-QGMBQPNBSA-N |
| XLogP | 6.11 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|