C39H42N2O5 — CID 18393241
benzyl (2S)-2-[[[3-(2,3-dihydro-1H-inden-5-yloxy)-3-oxopropyl]-(2-methylpropyl)carbamoyl]amino]-3-(4-phenylphenyl)propanoate (PubChem CID 18393241) has the molecular formula C39H42N2O5 and a molecular weight of 618.77 g/mol. Its IUPAC name is benzyl (2S)-2-[[[3-(2,3-dihydro-1H-inden-5-yloxy)-3-oxopropyl]-(2-methylpropyl)carbamoyl]amino]-3-(4-phenylphenyl)propanoate.
| Compound Name | benzyl (2S)-2-[[[3-(2,3-dihydro-1H-inden-5-yloxy)-3-oxopropyl]-(2-methylpropyl)carbamoyl]amino]-3-(4-phenylphenyl)propanoate |
|---|---|
| PubChem CID | 18393241 |
| Molecular Formula | C39H42N2O5 |
| Molecular Weight | 618.77 g/mol |
| Exact Mass | 618.31 |
| IUPAC Name | benzyl (2S)-2-[[[3-(2,3-dihydro-1H-inden-5-yloxy)-3-oxopropyl]-(2-methylpropyl)carbamoyl]amino]-3-(4-phenylphenyl)propanoate |
| SMILES | CC(C)CN(CCC(=O)Oc1ccc2c(c1)CCC2)C(=O)N[C@@H](Cc1ccc(-c2ccccc2)cc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C39H42N2O5/c1-28(2)26-41(23-22-37(42)46-35-21-20-32-14-9-15-34(32)25-35)39(44)40-36(38(43)45-27-30-10-5-3-6-11-30)24-29-16-18-33(19-17-29)31-12-7-4-8-13-31/h3-8,10-13,16-21,25,28,36H,9,14-15,22-24,26-27H2,1-2H3,(H,40,44)/t36-/m0/s1 |
| InChIKey | AAPVTJHMYXDMQC-BHVANESWSA-N |
| XLogP | 7.16 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.77 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|