C18H34O4 — CID 18393298
(3S,6R,7S,8S)-1,3,7-trihydroxy-4,4,6,8,12-pentamethyltridec-12-en-5-one (PubChem CID 18393298) has the molecular formula C18H34O4 and a molecular weight of 314.47 g/mol. Its IUPAC name is (3S,6R,7S,8S)-1,3,7-trihydroxy-4,4,6,8,12-pentamethyltridec-12-en-5-one.
| Compound Name | (3S,6R,7S,8S)-1,3,7-trihydroxy-4,4,6,8,12-pentamethyltridec-12-en-5-one |
|---|---|
| PubChem CID | 18393298 |
| Molecular Formula | C18H34O4 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | (3S,6R,7S,8S)-1,3,7-trihydroxy-4,4,6,8,12-pentamethyltridec-12-en-5-one |
| SMILES | C=C(C)CCC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CCO |
| InChI | InChI=1S/C18H34O4/c1-12(2)8-7-9-13(3)16(21)14(4)17(22)18(5,6)15(20)10-11-19/h13-16,19-21H,1,7-11H2,2-6H3/t13-,14+,15-,16-/m0/s1 |
| InChIKey | ADLOLDNFUSHTEF-FZKCQIBNSA-N |
| XLogP | 2.70 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|