C29H60O4Si2 — CID 18393301
(3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-1-hydroxy-4,4,6,8-tetramethyltridec-12-en-5-one (PubChem CID 18393301) has the molecular formula C29H60O4Si2 and a molecular weight of 528.97 g/mol. Its IUPAC name is (3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-1-hydroxy-4,4,6,8-tetramethyltridec-12-en-5-one.
| Compound Name | (3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-1-hydroxy-4,4,6,8-tetramethyltridec-12-en-5-one |
|---|---|
| PubChem CID | 18393301 |
| Molecular Formula | C29H60O4Si2 |
| Molecular Weight | 528.97 g/mol |
| Exact Mass | 528.40 |
| IUPAC Name | (3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-1-hydroxy-4,4,6,8-tetramethyltridec-12-en-5-one |
| SMILES | C=CCCC[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)C(C)(C)[C@H](CCO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H60O4Si2/c1-16-17-18-19-22(2)25(33-35(14,15)28(7,8)9)23(3)26(31)29(10,11)24(20-21-30)32-34(12,13)27(4,5)6/h16,22-25,30H,1,17-21H2,2-15H3/t22-,23+,24-,25-/m0/s1 |
| InChIKey | LNVBFJGTRXMGPO-NDBXHCKUSA-N |
| XLogP | 8.37 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.97 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|