C35H32F18O4 — CID 18393330
7-[(2S)-3-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy]-2-fluoropropoxy]-1,2-difluoro-3-(4-octylphenyl)naphthalene (PubChem CID 18393330) has the molecular formula C35H32F18O4 and a molecular weight of 858.60 g/mol. Its IUPAC name is 7-[(2S)-3-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy]-2-fluoropropoxy]-1,2-difluoro-3-(4-octylphenyl)naphthalene.
| Compound Name | 7-[(2S)-3-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy]-2-fluoropropoxy]-1,2-difluoro-3-(4-octylphenyl)naphthalene |
|---|---|
| PubChem CID | 18393330 |
| Molecular Formula | C35H32F18O4 |
| Molecular Weight | 858.60 g/mol |
| Exact Mass | 858.20 |
| IUPAC Name | 7-[(2S)-3-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy]-2-fluoropropoxy]-1,2-difluoro-3-(4-octylphenyl)naphthalene |
| SMILES | CCCCCCCCc1ccc(-c2cc3ccc(OC[C@@H](F)COCC(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc3c(F)c2F)cc1 |
| InChI | InChI=1S/C35H32F18O4/c1-2-3-4-5-6-7-8-20-9-11-21(12-10-20)25-15-22-13-14-24(16-26(22)28(38)27(25)37)55-18-23(36)17-54-19-29(39,40)56-34(50,51)35(52,53)57-33(48,49)31(43,44)30(41,42)32(45,46)47/h9-16,23H,2-8,17-19H2,1H3/t23-/m0/s1 |
| InChIKey | CFDZXSWVEHZXNH-QHCPKHFHSA-N |
| XLogP | 12.66 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.60 |
| LogP ≤ 5 | 12.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|