C9H16O7S — CID 18393341
[(3aR,4R,6S,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanesulfonic acid (PubChem CID 18393341) has the molecular formula C9H16O7S and a molecular weight of 268.29 g/mol. Its IUPAC name is [(3aR,4R,6S,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanesulfonic acid.
| Compound Name | [(3aR,4R,6S,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 18393341 |
| Molecular Formula | C9H16O7S |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | [(3aR,4R,6S,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanesulfonic acid |
| SMILES | CO[C@@H]1O[C@H](CS(=O)(=O)O)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C9H16O7S/c1-9(2)15-6-5(4-17(10,11)12)14-8(13-3)7(6)16-9/h5-8H,4H2,1-3H3,(H,10,11,12)/t5-,6-,7-,8-/m1/s1 |
| InChIKey | YGSIZLWCZAEMGA-WCTZXXKLSA-N |
| XLogP | -0.23 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|