C38H50N2O5 — CID 18393608
[(4R,4aR,7S,7aR,12bS)-7-[butyl(6-phenylhexanoyl)amino]-3-(cyclopropylmethyl)-11-hydroxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate (PubChem CID 18393608) has the molecular formula C38H50N2O5 and a molecular weight of 614.83 g/mol. Its IUPAC name is [(4R,4aR,7S,7aR,12bS)-7-[butyl(6-phenylhexanoyl)amino]-3-(cyclopropylmethyl)-11-hydroxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate.
| Compound Name | [(4R,4aR,7S,7aR,12bS)-7-[butyl(6-phenylhexanoyl)amino]-3-(cyclopropylmethyl)-11-hydroxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate |
|---|---|
| PubChem CID | 18393608 |
| Molecular Formula | C38H50N2O5 |
| Molecular Weight | 614.83 g/mol |
| Exact Mass | 614.37 |
| IUPAC Name | [(4R,4aR,7S,7aR,12bS)-7-[butyl(6-phenylhexanoyl)amino]-3-(cyclopropylmethyl)-11-hydroxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate |
| SMILES | CCCCN(C(=O)CCCCCc1ccccc1)[C@H]1CC[C@H]2[C@H]3Cc4c(O)cc(OC(C)=O)c5c4[C@@]2(CCN3CC2CC2)[C@H]1O5 |
| InChI | InChI=1S/C38H50N2O5/c1-3-4-20-40(34(43)14-10-6-9-13-26-11-7-5-8-12-26)30-18-17-29-31-22-28-32(42)23-33(44-25(2)41)36-35(28)38(29,37(30)45-36)19-21-39(31)24-27-15-16-27/h5,7-8,11-12,23,27,29-31,37,42H,3-4,6,9-10,13-22,24H2,1-2H3/t29-,30-,31+,37-,38-/m0/s1 |
| InChIKey | KZYDJMKLXRDXKN-LOIKPCJPSA-N |
| XLogP | 6.57 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.83 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|