About (2R)-2-amino-4-(3,4-dichlorophenyl)-4-oxobutanoic acid
(2R)-2-amino-4-(3,4-dichlorophenyl)-4-oxobutanoic acid (PubChem CID 18393848) has the molecular formula C10H9Cl2NO3
and a molecular weight of 262.09 g/mol. Its IUPAC name is (2R)-2-amino-4-(3,4-dichlorophenyl)-4-oxobutanoic acid.
Molecular Properties
| Compound Name | (2R)-2-amino-4-(3,4-dichlorophenyl)-4-oxobutanoic acid |
| PubChem CID | 18393848 |
| Molecular Formula | C10H9Cl2NO3 |
| Molecular Weight | 262.09 g/mol |
| Exact Mass | 261.00 |
| IUPAC Name | (2R)-2-amino-4-(3,4-dichlorophenyl)-4-oxobutanoic acid |
| SMILES | N[C@H](CC(=O)c1ccc(Cl)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C10H9Cl2NO3/c11-6-2-1-5(3-7(6)12)9(14)4-8(13)10(15)16/h1-3,8H,4,13H2,(H,15,16)/t8-/m1/s1 |
| InChIKey | MXBKZYGNMKXYQE-MRVPVSSYSA-N |
| XLogP | 1.98 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.09 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-2-amino-4-(3,4-dichlorophenyl)-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-4-(3,4-dichlorophenyl)-4-oxobutanoic acid?
The IUPAC name of (2R)-2-amino-4-(3,4-dichlorophenyl)-4-oxobutanoic acid (CID 18393848) is (2R)-2-amino-4-(3,4-dichlorophenyl)-4-oxobutanoic acid.
What is the SMILES notation for (2R)-2-amino-4-(3,4-dichlorophenyl)-4-oxobutanoic acid?
The canonical SMILES for (2R)-2-amino-4-(3,4-dichlorophenyl)-4-oxobutanoic acid is N[C@H](CC(=O)c1ccc(Cl)c(Cl)c1)C(=O)O.
What is the InChIKey of (2R)-2-amino-4-(3,4-dichlorophenyl)-4-oxobutanoic acid?
The InChIKey is MXBKZYGNMKXYQE-MRVPVSSYSA-N. The full InChI is InChI=1S/C10H9Cl2NO3/c11-6-2-1-5(3-7(6)12)9(14)4-8(13)10(15)16/h1-3,8H,4,13H2,(H,15,16)/t8-/m1/s1.
What are the key properties of (2R)-2-amino-4-(3,4-dichlorophenyl)-4-oxobutanoic acid?
(2R)-2-amino-4-(3,4-dichlorophenyl)-4-oxobutanoic acid has a molecular weight of 262.09 g/mol, XLogP of 1.98, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-4-(3,4-dichlorophenyl)-4-oxobutanoic acid is sourced from PubChem (CID 18393848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).