C25H43N5O6S — CID 18394501
S-[1-[[(2S)-1-[[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxo-4-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)butan-2-yl] ethanethioate (PubChem CID 18394501) has the molecular formula C25H43N5O6S and a molecular weight of 541.72 g/mol. Its IUPAC name is S-[1-[[(2S)-1-[[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxo-4-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)butan-2-yl] ethanethioate.
| Compound Name | S-[1-[[(2S)-1-[[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxo-4-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)butan-2-yl] ethanethioate |
|---|---|
| PubChem CID | 18394501 |
| Molecular Formula | C25H43N5O6S |
| Molecular Weight | 541.72 g/mol |
| Exact Mass | 541.29 |
| IUPAC Name | S-[1-[[(2S)-1-[[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxo-4-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)butan-2-yl] ethanethioate |
| SMILES | CNC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)C(CCN1C(=O)N(C)C(C)(C)C1=O)SC(C)=O)C(C)(C)C |
| InChI | InChI=1S/C25H43N5O6S/c1-14(2)13-16(19(32)28-18(21(34)26-9)24(4,5)6)27-20(33)17(37-15(3)31)11-12-30-22(35)25(7,8)29(10)23(30)36/h14,16-18H,11-13H2,1-10H3,(H,26,34)(H,27,33)(H,28,32)/t16-,17?,18+/m0/s1 |
| InChIKey | BIRXHQREZOQBDX-PXKIYYGHSA-N |
| XLogP | 1.51 |
| TPSA | 144.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.72 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|