C25H30Cl2F2O6 — CID 18394569
ethyl (6S,8S,9R,10S,11S,13S,14S,16R,17R)-17-(2,2-dichloroacetyl)oxy-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxylate (PubChem CID 18394569) has the molecular formula C25H30Cl2F2O6 and a molecular weight of 535.41 g/mol. Its IUPAC name is ethyl (6S,8S,9R,10S,11S,13S,14S,16R,17R)-17-(2,2-dichloroacetyl)oxy-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxylate.
| Compound Name | ethyl (6S,8S,9R,10S,11S,13S,14S,16R,17R)-17-(2,2-dichloroacetyl)oxy-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxylate |
|---|---|
| PubChem CID | 18394569 |
| Molecular Formula | C25H30Cl2F2O6 |
| Molecular Weight | 535.41 g/mol |
| Exact Mass | 534.14 |
| IUPAC Name | ethyl (6S,8S,9R,10S,11S,13S,14S,16R,17R)-17-(2,2-dichloroacetyl)oxy-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxylate |
| SMILES | CCOC(=O)[C@@]1(OC(=O)C(Cl)Cl)[C@H](C)C[C@H]2[C@@H]3C[C@H](F)C4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@@]21C |
| InChI | InChI=1S/C25H30Cl2F2O6/c1-5-34-21(33)25(35-20(32)19(26)27)12(2)8-14-15-10-17(28)16-9-13(30)6-7-22(16,3)24(15,29)18(31)11-23(14,25)4/h6-7,9,12,14-15,17-19,31H,5,8,10-11H2,1-4H3/t12-,14+,15+,17+,18+,22+,23+,24+,25+/m1/s1 |
| InChIKey | AVQCCTKWCSNCEF-MKPGGGGISA-N |
| XLogP | 4.20 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.41 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|