C18H21N3O6S — CID 18395141
(4S,5R,6S)-3-[[2,5-bis(hydroxymethyl)imidazo[5,1-b][1,3]thiazol-6-ium-6-yl]methyl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 18395141) has the molecular formula C18H21N3O6S and a molecular weight of 407.45 g/mol. Its IUPAC name is (4S,5R,6S)-3-[[2,5-bis(hydroxymethyl)imidazo[5,1-b][1,3]thiazol-6-ium-6-yl]methyl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | (4S,5R,6S)-3-[[2,5-bis(hydroxymethyl)imidazo[5,1-b][1,3]thiazol-6-ium-6-yl]methyl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 18395141 |
| Molecular Formula | C18H21N3O6S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | (4S,5R,6S)-3-[[2,5-bis(hydroxymethyl)imidazo[5,1-b][1,3]thiazol-6-ium-6-yl]methyl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | C[C@@H](O)[C@H]1C(=O)N2C(C(=O)[O-])=C(C[n+]3cc4sc(CO)cn4c3CO)[C@H](C)[C@H]12 |
| InChI | InChI=1S/C18H21N3O6S/c1-8-11(16(18(26)27)21-15(8)14(9(2)24)17(21)25)4-19-5-13-20(12(19)7-23)3-10(6-22)28-13/h3,5,8-9,14-15,22-24H,4,6-7H2,1-2H3/t8-,9+,14+,15+/m0/s1 |
| InChIKey | IJNZEKHFOVXCFJ-MAUFJKMRSA-N |
| XLogP | -1.87 |
| TPSA | 129.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|