4H-pyran-2-carboxylic acid

C6H6O3 — CID 18395243

IUPAC4H-pyran-2-carboxylic acid
SMILESO=C(O)C1=CCC=CO1
InChIInChI=1S/C6H6O3/c7-6(8)5-3-1-2-4-9-5/h2-4H,1H2,(H,7,8)
InChIKeyJYKZIOMYJRDGJQ-UHFFFAOYSA-N
MW126.11 g/mol
LogP0.89
Rot. Bonds1

About 4H-pyran-2-carboxylic acid

4H-pyran-2-carboxylic acid (PubChem CID 18395243) has the molecular formula C6H6O3 and a molecular weight of 126.11 g/mol. Its IUPAC name is 4H-pyran-2-carboxylic acid.

Molecular Properties

Compound Name4H-pyran-2-carboxylic acid
PubChem CID18395243
Molecular FormulaC6H6O3
Molecular Weight126.11 g/mol
Exact Mass126.03
IUPAC Name4H-pyran-2-carboxylic acid
SMILESO=C(O)C1=CCC=CO1
InChIInChI=1S/C6H6O3/c7-6(8)5-3-1-2-4-9-5/h2-4H,1H2,(H,7,8)
InChIKeyJYKZIOMYJRDGJQ-UHFFFAOYSA-N
XLogP0.89
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500126.11
LogP ≤ 50.89
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4H-pyran-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4H-pyran-2-carboxylic acid?
The IUPAC name of 4H-pyran-2-carboxylic acid (CID 18395243) is 4H-pyran-2-carboxylic acid.
What is the SMILES notation for 4H-pyran-2-carboxylic acid?
The canonical SMILES for 4H-pyran-2-carboxylic acid is O=C(O)C1=CCC=CO1.
What is the InChIKey of 4H-pyran-2-carboxylic acid?
The InChIKey is JYKZIOMYJRDGJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O3/c7-6(8)5-3-1-2-4-9-5/h2-4H,1H2,(H,7,8).
What are the key properties of 4H-pyran-2-carboxylic acid?
4H-pyran-2-carboxylic acid has a molecular weight of 126.11 g/mol, XLogP of 0.89, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-pyran-2-carboxylic acid is sourced from PubChem (CID 18395243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).