About 4H-pyran-2-carboxylic acid
4H-pyran-2-carboxylic acid (PubChem CID 18395243) has the molecular formula C6H6O3
and a molecular weight of 126.11 g/mol. Its IUPAC name is 4H-pyran-2-carboxylic acid.
Molecular Properties
| Compound Name | 4H-pyran-2-carboxylic acid |
| PubChem CID | 18395243 |
| Molecular Formula | C6H6O3 |
| Molecular Weight | 126.11 g/mol |
| Exact Mass | 126.03 |
| IUPAC Name | 4H-pyran-2-carboxylic acid |
| SMILES | O=C(O)C1=CCC=CO1 |
| InChI | InChI=1S/C6H6O3/c7-6(8)5-3-1-2-4-9-5/h2-4H,1H2,(H,7,8) |
| InChIKey | JYKZIOMYJRDGJQ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.11 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4H-pyran-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-pyran-2-carboxylic acid?
The IUPAC name of 4H-pyran-2-carboxylic acid (CID 18395243) is 4H-pyran-2-carboxylic acid.
What is the SMILES notation for 4H-pyran-2-carboxylic acid?
The canonical SMILES for 4H-pyran-2-carboxylic acid is O=C(O)C1=CCC=CO1.
What is the InChIKey of 4H-pyran-2-carboxylic acid?
The InChIKey is JYKZIOMYJRDGJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O3/c7-6(8)5-3-1-2-4-9-5/h2-4H,1H2,(H,7,8).
What are the key properties of 4H-pyran-2-carboxylic acid?
4H-pyran-2-carboxylic acid has a molecular weight of 126.11 g/mol, XLogP of 0.89, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-pyran-2-carboxylic acid is sourced from PubChem (CID 18395243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).