C27H40O4S — CID 18395441
6-[(4R,5S)-4-hydroxy-5-[(E,3S)-3-hydroxyoct-1-enyl]-2-(2-phenylethyl)cyclopenten-1-yl]sulfanylhexanoic acid (PubChem CID 18395441) has the molecular formula C27H40O4S and a molecular weight of 460.68 g/mol. Its IUPAC name is 6-[(4R,5S)-4-hydroxy-5-[(E,3S)-3-hydroxyoct-1-enyl]-2-(2-phenylethyl)cyclopenten-1-yl]sulfanylhexanoic acid.
| Compound Name | 6-[(4R,5S)-4-hydroxy-5-[(E,3S)-3-hydroxyoct-1-enyl]-2-(2-phenylethyl)cyclopenten-1-yl]sulfanylhexanoic acid |
|---|---|
| PubChem CID | 18395441 |
| Molecular Formula | C27H40O4S |
| Molecular Weight | 460.68 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | 6-[(4R,5S)-4-hydroxy-5-[(E,3S)-3-hydroxyoct-1-enyl]-2-(2-phenylethyl)cyclopenten-1-yl]sulfanylhexanoic acid |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1C(SCCCCCC(=O)O)=C(CCc2ccccc2)C[C@H]1O |
| InChI | InChI=1S/C27H40O4S/c1-2-3-6-13-23(28)17-18-24-25(29)20-22(16-15-21-11-7-4-8-12-21)27(24)32-19-10-5-9-14-26(30)31/h4,7-8,11-12,17-18,23-25,28-29H,2-3,5-6,9-10,13-16,19-20H2,1H3,(H,30,31)/b18-17+/t23-,24-,25+/m0/s1 |
| InChIKey | IXZZEUWVRJNOFG-IDLZKXNDSA-N |
| XLogP | 6.13 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.68 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|