C20H31F3O4S — CID 18395442
6-[(4R,5S)-4-hydroxy-5-[(E,3S)-3-hydroxyoct-1-enyl]-2-(trifluoromethyl)cyclopenten-1-yl]sulfanylhexanoic acid (PubChem CID 18395442) has the molecular formula C20H31F3O4S and a molecular weight of 424.53 g/mol. Its IUPAC name is 6-[(4R,5S)-4-hydroxy-5-[(E,3S)-3-hydroxyoct-1-enyl]-2-(trifluoromethyl)cyclopenten-1-yl]sulfanylhexanoic acid.
| Compound Name | 6-[(4R,5S)-4-hydroxy-5-[(E,3S)-3-hydroxyoct-1-enyl]-2-(trifluoromethyl)cyclopenten-1-yl]sulfanylhexanoic acid |
|---|---|
| PubChem CID | 18395442 |
| Molecular Formula | C20H31F3O4S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 6-[(4R,5S)-4-hydroxy-5-[(E,3S)-3-hydroxyoct-1-enyl]-2-(trifluoromethyl)cyclopenten-1-yl]sulfanylhexanoic acid |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1C(SCCCCCC(=O)O)=C(C(F)(F)F)C[C@H]1O |
| InChI | InChI=1S/C20H31F3O4S/c1-2-3-5-8-14(24)10-11-15-17(25)13-16(20(21,22)23)19(15)28-12-7-4-6-9-18(26)27/h10-11,14-15,17,24-25H,2-9,12-13H2,1H3,(H,26,27)/b11-10+/t14-,15-,17+/m0/s1 |
| InChIKey | IGHUTQLCQQVUAX-AMNBBVENSA-N |
| XLogP | 5.06 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|