C41H72O4SSi2 — CID 18395485
6-[(4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2-(2-phenylethyl)cyclopenten-1-yl]sulfanylhexanoic acid (PubChem CID 18395485) has the molecular formula C41H72O4SSi2 and a molecular weight of 717.26 g/mol. Its IUPAC name is 6-[(4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2-(2-phenylethyl)cyclopenten-1-yl]sulfanylhexanoic acid.
| Compound Name | 6-[(4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2-(2-phenylethyl)cyclopenten-1-yl]sulfanylhexanoic acid |
|---|---|
| PubChem CID | 18395485 |
| Molecular Formula | C41H72O4SSi2 |
| Molecular Weight | 717.26 g/mol |
| Exact Mass | 716.47 |
| IUPAC Name | 6-[(4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2-(2-phenylethyl)cyclopenten-1-yl]sulfanylhexanoic acid |
| SMILES | CCCC[C@@H](C)C[C@@H](/C=C/[C@@H]1C(SCCCCCC(=O)O)=C(CCc2ccccc2)C[C@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C41H72O4SSi2/c1-13-14-21-32(2)30-35(44-47(9,10)40(3,4)5)27-28-36-37(45-48(11,12)41(6,7)8)31-34(26-25-33-22-17-15-18-23-33)39(36)46-29-20-16-19-24-38(42)43/h15,17-18,22-23,27-28,32,35-37H,13-14,16,19-21,24-26,29-31H2,1-12H3,(H,42,43)/b28-27+/t32-,35-,36+,37-/m1/s1 |
| InChIKey | KILNHKYEOBRKFB-RGNHRLMUSA-N |
| XLogP | 12.82 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.26 |
| LogP ≤ 5 | 12.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|