C10H16N2O3S — CID 18395845
(3aS,6R,6aR)-6-cyclopropyl-4-methylsulfonyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,2-b]pyrrol-5-one (PubChem CID 18395845) has the molecular formula C10H16N2O3S and a molecular weight of 244.32 g/mol. Its IUPAC name is (3aS,6R,6aR)-6-cyclopropyl-4-methylsulfonyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,2-b]pyrrol-5-one.
| Compound Name | (3aS,6R,6aR)-6-cyclopropyl-4-methylsulfonyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,2-b]pyrrol-5-one |
|---|---|
| PubChem CID | 18395845 |
| Molecular Formula | C10H16N2O3S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | (3aS,6R,6aR)-6-cyclopropyl-4-methylsulfonyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,2-b]pyrrol-5-one |
| SMILES | CS(=O)(=O)N1C(=O)[C@H](C2CC2)[C@H]2NCC[C@@H]21 |
| InChI | InChI=1S/C10H16N2O3S/c1-16(14,15)12-7-4-5-11-9(7)8(10(12)13)6-2-3-6/h6-9,11H,2-5H2,1H3/t7-,8+,9-/m0/s1 |
| InChIKey | QQHUBOHXQHXQRG-YIZRAAEISA-N |
| XLogP | -0.46 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |