About (2R)-4-ethyl-1,1,1-trifluorohexan-2-ol
(2R)-4-ethyl-1,1,1-trifluorohexan-2-ol (PubChem CID 18396349) has the molecular formula C8H15F3O
and a molecular weight of 184.20 g/mol. Its IUPAC name is (2R)-4-ethyl-1,1,1-trifluorohexan-2-ol.
Molecular Properties
| Compound Name | (2R)-4-ethyl-1,1,1-trifluorohexan-2-ol |
| PubChem CID | 18396349 |
| Molecular Formula | C8H15F3O |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | (2R)-4-ethyl-1,1,1-trifluorohexan-2-ol |
| SMILES | CCC(CC)C[C@@H](O)C(F)(F)F |
| InChI | InChI=1S/C8H15F3O/c1-3-6(4-2)5-7(12)8(9,10)11/h6-7,12H,3-5H2,1-2H3/t7-/m1/s1 |
| InChIKey | NADPOJFRLDKLBR-SSDOTTSWSA-N |
| XLogP | 2.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R)-4-ethyl-1,1,1-trifluorohexan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-4-ethyl-1,1,1-trifluorohexan-2-ol?
The IUPAC name of (2R)-4-ethyl-1,1,1-trifluorohexan-2-ol (CID 18396349) is (2R)-4-ethyl-1,1,1-trifluorohexan-2-ol.
What is the SMILES notation for (2R)-4-ethyl-1,1,1-trifluorohexan-2-ol?
The canonical SMILES for (2R)-4-ethyl-1,1,1-trifluorohexan-2-ol is CCC(CC)C[C@@H](O)C(F)(F)F.
What is the InChIKey of (2R)-4-ethyl-1,1,1-trifluorohexan-2-ol?
The InChIKey is NADPOJFRLDKLBR-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H15F3O/c1-3-6(4-2)5-7(12)8(9,10)11/h6-7,12H,3-5H2,1-2H3/t7-/m1/s1.
What are the key properties of (2R)-4-ethyl-1,1,1-trifluorohexan-2-ol?
(2R)-4-ethyl-1,1,1-trifluorohexan-2-ol has a molecular weight of 184.20 g/mol, XLogP of 2.74, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-4-ethyl-1,1,1-trifluorohexan-2-ol is sourced from PubChem (CID 18396349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).