C31H36F2N2O3 — CID 18396392
(1S,3R)-1-(aminomethyl)-3-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-3,4-dihydro-1H-isochromene-5,6-diol (PubChem CID 18396392) has the molecular formula C31H36F2N2O3 and a molecular weight of 522.64 g/mol. Its IUPAC name is (1S,3R)-1-(aminomethyl)-3-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-3,4-dihydro-1H-isochromene-5,6-diol.
| Compound Name | (1S,3R)-1-(aminomethyl)-3-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-3,4-dihydro-1H-isochromene-5,6-diol |
|---|---|
| PubChem CID | 18396392 |
| Molecular Formula | C31H36F2N2O3 |
| Molecular Weight | 522.64 g/mol |
| Exact Mass | 522.27 |
| IUPAC Name | (1S,3R)-1-(aminomethyl)-3-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-3,4-dihydro-1H-isochromene-5,6-diol |
| SMILES | NC[C@H]1O[C@@H](C2CCN(CCCC(c3ccc(F)cc3)c3ccc(F)cc3)CC2)Cc2c1ccc(O)c2O |
| InChI | InChI=1S/C31H36F2N2O3/c32-23-7-3-20(4-8-23)25(21-5-9-24(33)10-6-21)2-1-15-35-16-13-22(14-17-35)29-18-27-26(30(19-34)38-29)11-12-28(36)31(27)37/h3-12,22,25,29-30,36-37H,1-2,13-19,34H2/t29-,30-/m1/s1 |
| InChIKey | UREKPENCOYCBBW-LOYHVIPDSA-N |
| XLogP | 5.64 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.64 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|