C24H31FN2O3 — CID 18396394
(1R,3R)-1-[2-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]-3-(methylaminomethyl)-3,4-dihydro-1H-isochromene-5,6-diol (PubChem CID 18396394) has the molecular formula C24H31FN2O3 and a molecular weight of 414.52 g/mol. Its IUPAC name is (1R,3R)-1-[2-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]-3-(methylaminomethyl)-3,4-dihydro-1H-isochromene-5,6-diol.
| Compound Name | (1R,3R)-1-[2-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]-3-(methylaminomethyl)-3,4-dihydro-1H-isochromene-5,6-diol |
|---|---|
| PubChem CID | 18396394 |
| Molecular Formula | C24H31FN2O3 |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | (1R,3R)-1-[2-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]-3-(methylaminomethyl)-3,4-dihydro-1H-isochromene-5,6-diol |
| SMILES | CNC[C@H]1Cc2c(ccc(O)c2O)[C@@H](C2CCNC(CCc3ccc(F)cc3)C2)O1 |
| InChI | InChI=1S/C24H31FN2O3/c1-26-14-19-13-21-20(8-9-22(28)23(21)29)24(30-19)16-10-11-27-18(12-16)7-4-15-2-5-17(25)6-3-15/h2-3,5-6,8-9,16,18-19,24,26-29H,4,7,10-14H2,1H3/t16?,18?,19-,24-/m1/s1 |
| InChIKey | WAXMPSIAYQAGRF-RTOXBSCNSA-N |
| XLogP | 3.44 |
| TPSA | 73.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|