C25H34N2O4 — CID 18396395
(1S,3R)-3-[4-[2-(4-methoxyphenyl)ethyl]piperidin-4-yl]-1-(methylaminomethyl)-3,4-dihydro-1H-isochromene-5,6-diol (PubChem CID 18396395) has the molecular formula C25H34N2O4 and a molecular weight of 426.56 g/mol. Its IUPAC name is (1S,3R)-3-[4-[2-(4-methoxyphenyl)ethyl]piperidin-4-yl]-1-(methylaminomethyl)-3,4-dihydro-1H-isochromene-5,6-diol.
| Compound Name | (1S,3R)-3-[4-[2-(4-methoxyphenyl)ethyl]piperidin-4-yl]-1-(methylaminomethyl)-3,4-dihydro-1H-isochromene-5,6-diol |
|---|---|
| PubChem CID | 18396395 |
| Molecular Formula | C25H34N2O4 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | (1S,3R)-3-[4-[2-(4-methoxyphenyl)ethyl]piperidin-4-yl]-1-(methylaminomethyl)-3,4-dihydro-1H-isochromene-5,6-diol |
| SMILES | CNC[C@H]1O[C@@H](C2(CCc3ccc(OC)cc3)CCNCC2)Cc2c1ccc(O)c2O |
| InChI | InChI=1S/C25H34N2O4/c1-26-16-22-19-7-8-21(28)24(29)20(19)15-23(31-22)25(11-13-27-14-12-25)10-9-17-3-5-18(30-2)6-4-17/h3-8,22-23,26-29H,9-16H2,1-2H3/t22-,23-/m1/s1 |
| InChIKey | MNHCBWMPBRIUIV-DHIUTWEWSA-N |
| XLogP | 3.31 |
| TPSA | 82.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|