C36H34N4O9 — CID 18396557
1-O-benzyl 3-O-tert-butyl 2-[(2S)-2-(1,3-dioxoisoindol-2-yl)-3-(phenylmethoxycarbonylamino)propanoyl]pyridazine-1,3-dicarboxylate (PubChem CID 18396557) has the molecular formula C36H34N4O9 and a molecular weight of 666.69 g/mol. Its IUPAC name is 1-O-benzyl 3-O-tert-butyl 2-[(2S)-2-(1,3-dioxoisoindol-2-yl)-3-(phenylmethoxycarbonylamino)propanoyl]pyridazine-1,3-dicarboxylate.
| Compound Name | 1-O-benzyl 3-O-tert-butyl 2-[(2S)-2-(1,3-dioxoisoindol-2-yl)-3-(phenylmethoxycarbonylamino)propanoyl]pyridazine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 18396557 |
| Molecular Formula | C36H34N4O9 |
| Molecular Weight | 666.69 g/mol |
| Exact Mass | 666.23 |
| IUPAC Name | 1-O-benzyl 3-O-tert-butyl 2-[(2S)-2-(1,3-dioxoisoindol-2-yl)-3-(phenylmethoxycarbonylamino)propanoyl]pyridazine-1,3-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)C1=CC=CN(C(=O)OCc2ccccc2)N1C(=O)[C@H](CNC(=O)OCc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C36H34N4O9/c1-36(2,3)49-33(44)28-19-12-20-38(35(46)48-23-25-15-8-5-9-16-25)40(28)32(43)29(21-37-34(45)47-22-24-13-6-4-7-14-24)39-30(41)26-17-10-11-18-27(26)31(39)42/h4-20,29H,21-23H2,1-3H3,(H,37,45)/t29-/m0/s1 |
| InChIKey | GPCOMYALPHTQOY-LJAQVGFWSA-N |
| XLogP | 4.71 |
| TPSA | 151.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.69 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|